Difference between revisions of "O-SUCCINYL-L-HOMOSERINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 23S-rRNA-uridine2457 == * common-name: ** uridine2457 in 23s rrna == Reaction(s) known to consume the compound == * RXN-11834 == Reac...") |
(Created page with "Category:metabolite == Metabolite 5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE == * common-name: ** 5-amino-1-(5-phospho-β-d-ribosyl)imidazole * smiles: ** c2([n+]=cn(c1(oc(cop(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE == |
* common-name: | * common-name: | ||
− | ** | + | ** 5-amino-1-(5-phospho-β-d-ribosyl)imidazole |
+ | * smiles: | ||
+ | ** c2([n+]=cn(c1(oc(cop([o-])(=o)[o-])c(o)c(o)1))c(n)=2) | ||
+ | * inchi-key: | ||
+ | ** pdacukokvhbvhj-xvfcmesisa-m | ||
+ | * molecular-weight: | ||
+ | ** 294.18 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[AIRCARBOXY-RXN]] |
+ | * [[PYRIMSYN1-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[AIRCARBOXY-RXN]] | ||
+ | * [[AIRS-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=5-amino-1-(5-phospho-β-d-ribosyl)imidazole}} |
+ | {{#set: inchi-key=inchikey=pdacukokvhbvhj-xvfcmesisa-m}} | ||
+ | {{#set: molecular-weight=294.18}} |
Revision as of 14:55, 5 January 2021
Contents
Metabolite 5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE
- common-name:
- 5-amino-1-(5-phospho-β-d-ribosyl)imidazole
- smiles:
- c2([n+]=cn(c1(oc(cop([o-])(=o)[o-])c(o)c(o)1))c(n)=2)
- inchi-key:
- pdacukokvhbvhj-xvfcmesisa-m
- molecular-weight:
- 294.18