Difference between revisions of "O-SUCCINYL-L-HOMOSERINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite O-SUCCINYL-L-HOMOSERINE == * common-name: ** o-succinyl-l-homoserine * smiles: ** c(cc(=o)occc(c([o-])=o)[n+])c([o-])=o * inchi-key: ** g...")
(Created page with "Category:metabolite == Metabolite Rhodopsins == * common-name: ** a rhodopsin == Reaction(s) known to consume the compound == * 2.7.11.14-RXN == Reaction(s) known to p...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite O-SUCCINYL-L-HOMOSERINE ==
+
== Metabolite Rhodopsins ==
 
* common-name:
 
* common-name:
** o-succinyl-l-homoserine
+
** a rhodopsin
* smiles:
 
** c(cc(=o)occc(c([o-])=o)[n+])c([o-])=o
 
* inchi-key:
 
** gnisqjgxjidkdj-yfkpbyrvsa-m
 
* molecular-weight:
 
** 218.186
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[METBALT-RXN]]
+
* [[2.7.11.14-RXN]]
* [[O-SUCCHOMOSERLYASE-RXN]]
 
* [[RXN-9384]]
 
* [[SUCHMSSELCYSL]]
 
* [[SUCHMSSELCYSLh]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HOMSUCTRAN-RXN]]
+
* [[2.7.11.14-RXN]]
* [[O-SUCCHOMOSERLYASE-RXN]]
 
* [[RXN-9384]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=o-succinyl-l-homoserine}}
+
{{#set: common-name=a rhodopsin}}
{{#set: inchi-key=inchikey=gnisqjgxjidkdj-yfkpbyrvsa-m}}
 
{{#set: molecular-weight=218.186}}
 

Revision as of 13:08, 14 January 2021

Metabolite Rhodopsins

  • common-name:
    • a rhodopsin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality