Difference between revisions of "O-SUCCINYLBENZOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite S-CD-S-SP-Complex == * common-name: ** an s-sulfanyl-[cysteine desulfurase]-s-sulfanyl-[disordered-form scaffold protein] complex == Reac...")
(Created page with "Category:metabolite == Metabolite O-SUCCINYLBENZOATE == * common-name: ** 2-succinylbenzoate * smiles: ** c1(c=cc(c(=o)[o-])=c(c=1)c(=o)ccc(=o)[o-]) * inchi-key: ** yivwqn...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite S-CD-S-SP-Complex ==
+
== Metabolite O-SUCCINYLBENZOATE ==
 
* common-name:
 
* common-name:
** an s-sulfanyl-[cysteine desulfurase]-s-sulfanyl-[disordered-form scaffold protein] complex
+
** 2-succinylbenzoate
 +
* smiles:
 +
** c1(c=cc(c(=o)[o-])=c(c=1)c(=o)ccc(=o)[o-])
 +
* inchi-key:
 +
** yivwqnvqrxfzjb-uhfffaoysa-l
 +
* molecular-weight:
 +
** 220.181
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14386]]
+
* [[O-SUCCINYLBENZOATE-COA-LIG-RXN]]
 +
* [[RXN-7614]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14385]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an s-sulfanyl-[cysteine desulfurase]-s-sulfanyl-[disordered-form scaffold protein] complex}}
+
{{#set: common-name=2-succinylbenzoate}}
 +
{{#set: inchi-key=inchikey=yivwqnvqrxfzjb-uhfffaoysa-l}}
 +
{{#set: molecular-weight=220.181}}

Latest revision as of 11:16, 18 March 2021

Metabolite O-SUCCINYLBENZOATE

  • common-name:
    • 2-succinylbenzoate
  • smiles:
    • c1(c=cc(c(=o)[o-])=c(c=1)c(=o)ccc(=o)[o-])
  • inchi-key:
    • yivwqnvqrxfzjb-uhfffaoysa-l
  • molecular-weight:
    • 220.181

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality