Difference between revisions of "O-SUCCINYLBENZOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7013 == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c)c5(=n([mg]36(n1(=c(c(cc)=c([ch]=o)c1=cc=2n34)c...")
(Created page with "Category:metabolite == Metabolite O-SUCCINYLBENZOATE == * common-name: ** 2-succinylbenzoate * smiles: ** c1(c=cc(c(=o)[o-])=c(c=1)c(=o)ccc(=o)[o-]) * inchi-key: ** yivwqn...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7013 ==
+
== Metabolite O-SUCCINYLBENZOATE ==
 +
* common-name:
 +
** 2-succinylbenzoate
 
* smiles:
 
* smiles:
** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c)c5(=n([mg]36(n1(=c(c(cc)=c([ch]=o)c1=cc=2n34)c=c7(c(c)=c8(c(=o)c(c(oc)=o)c5=c(n67)8)))))9))))
+
** c1(c=cc(c(=o)[o-])=c(c=1)c(=o)ccc(=o)[o-])
* common-name:
+
* inchi-key:
** geranylgeranyl chlorophyll b
+
** yivwqnvqrxfzjb-uhfffaoysa-l
 
* molecular-weight:
 
* molecular-weight:
** 901.439
+
** 220.181
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7673]]
+
* [[O-SUCCINYLBENZOATE-COA-LIG-RXN]]
 +
* [[RXN-7614]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7673]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=geranylgeranyl chlorophyll b}}
+
{{#set: common-name=2-succinylbenzoate}}
{{#set: molecular-weight=901.439}}
+
{{#set: inchi-key=inchikey=yivwqnvqrxfzjb-uhfffaoysa-l}}
 +
{{#set: molecular-weight=220.181}}

Latest revision as of 11:16, 18 March 2021

Metabolite O-SUCCINYLBENZOATE

  • common-name:
    • 2-succinylbenzoate
  • smiles:
    • c1(c=cc(c(=o)[o-])=c(c=1)c(=o)ccc(=o)[o-])
  • inchi-key:
    • yivwqnvqrxfzjb-uhfffaoysa-l
  • molecular-weight:
    • 220.181

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality