Difference between revisions of "O-SUCCINYLBENZOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12928 == * common-name: ** 4α-carboxy-5α-cholesta-7,24-dien-3β-ol * inchi-key: ** bwhpoozligphhl-qpcstclvsa-m * mole...")
(Created page with "Category:metabolite == Metabolite O-SUCCINYLBENZOATE == * common-name: ** 2-succinylbenzoate * smiles: ** c1(c=cc(c(=o)[o-])=c(c=1)c(=o)ccc(=o)[o-]) * inchi-key: ** yivwqn...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12928 ==
+
== Metabolite O-SUCCINYLBENZOATE ==
 
* common-name:
 
* common-name:
** 4α-carboxy-5α-cholesta-7,24-dien-3β-ol
+
** 2-succinylbenzoate
 +
* smiles:
 +
** c1(c=cc(c(=o)[o-])=c(c=1)c(=o)ccc(=o)[o-])
 
* inchi-key:
 
* inchi-key:
** bwhpoozligphhl-qpcstclvsa-m
+
** yivwqnvqrxfzjb-uhfffaoysa-l
 
* molecular-weight:
 
* molecular-weight:
** 427.646
+
** 220.181
* smiles:
 
** cc(c)=ccc[c@@h](c)[c@@h]3(cc[c@@h]4(c1([c@@h]([c@]2(cc[c@h](o)[c@@h](c([o-])=o)[c@h](cc=1)2)(c))cc[c@](c)34)))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[O-SUCCINYLBENZOATE-COA-LIG-RXN]]
 +
* [[RXN-7614]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-21835]]
 
* [[RXN-21836]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4α-carboxy-5α-cholesta-7,24-dien-3β-ol}}
+
{{#set: common-name=2-succinylbenzoate}}
{{#set: inchi-key=inchikey=bwhpoozligphhl-qpcstclvsa-m}}
+
{{#set: inchi-key=inchikey=yivwqnvqrxfzjb-uhfffaoysa-l}}
{{#set: molecular-weight=427.646}}
+
{{#set: molecular-weight=220.181}}

Latest revision as of 11:16, 18 March 2021

Metabolite O-SUCCINYLBENZOATE

  • common-name:
    • 2-succinylbenzoate
  • smiles:
    • c1(c=cc(c(=o)[o-])=c(c=1)c(=o)ccc(=o)[o-])
  • inchi-key:
    • yivwqnvqrxfzjb-uhfffaoysa-l
  • molecular-weight:
    • 220.181

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality