Difference between revisions of "O-SUCCINYLBENZOATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11371 RXN-11371] == * direction: ** left-to-right * common-name: ** 2-(3-amino-3-carboxypropyl)...")
 
(Created page with "Category:metabolite == Metabolite O-SUCCINYLBENZOATE == * common-name: ** 2-succinylbenzoate * smiles: ** c1(c=cc(c(=o)[o-])=c(c=1)c(=o)ccc(=o)[o-]) * inchi-key: ** yivwqn...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11371 RXN-11371] ==
+
== Metabolite O-SUCCINYLBENZOATE ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** 2-(3-amino-3-carboxypropyl)histidine synthase
+
** 2-succinylbenzoate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.5.1.108 ec-2.5.1.108]
+
** c1(c=cc(c(=o)[o-])=c(c=1)c(=o)ccc(=o)[o-])
== Reaction formula ==
+
* inchi-key:
* 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[eEF-2-Histidines]][c] '''=>''' 1 [[2-3-CARBOXY-3-AMINOPROPYL-L-HISTIDINE]][c] '''+''' 1 [[5-METHYLTHIOADENOSINE]][c] '''+''' 1 [[PROTON]][c]
+
** yivwqnvqrxfzjb-uhfffaoysa-l
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ11657]]
+
** 220.181
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[O-SUCCINYLBENZOATE-COA-LIG-RXN]]
== Pathway(s) ==
+
* [[RXN-7614]]
* [[PWY-7546]], diphthamide biosynthesis II (eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7546 PWY-7546]
+
== Reaction(s) known to produce the compound ==
** '''4''' reactions found over '''4''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
* [[PWY-6482]], diphthamide biosynthesis I (archaea): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6482 PWY-6482]
+
{{#set: common-name=2-succinylbenzoate}}
** '''3''' reactions found over '''3''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=yivwqnvqrxfzjb-uhfffaoysa-l}}
== Reconstruction information  ==
+
{{#set: molecular-weight=220.181}}
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=36784 36784]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=2-(3-amino-3-carboxypropyl)histidine synthase}}
 
{{#set: ec-number=ec-2.5.1.108}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=2}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite O-SUCCINYLBENZOATE

  • common-name:
    • 2-succinylbenzoate
  • smiles:
    • c1(c=cc(c(=o)[o-])=c(c=1)c(=o)ccc(=o)[o-])
  • inchi-key:
    • yivwqnvqrxfzjb-uhfffaoysa-l
  • molecular-weight:
    • 220.181

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality