Difference between revisions of "O-SUCCINYLBENZOATE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATCD ATCD] == * direction: ** left-to-right * common-name: ** atp:cdp phosphotransferase == Reactio...") |
(Created page with "Category:metabolite == Metabolite ISOCHORISMATE == * common-name: ** isochorismate * smiles: ** c=c(c(=o)[o-])oc1(c=cc=c(c1o)c([o-])=o) * inchi-key: ** ntgwprccoqcmge-yumq...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite ISOCHORISMATE == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** isochorismate |
| − | = | + | * smiles: |
| − | + | ** c=c(c(=o)[o-])oc1(c=cc=c(c1o)c([o-])=o) | |
| − | == | + | * inchi-key: |
| − | * | + | ** ntgwprccoqcmge-yumqzzprsa-l |
| − | ** | + | * molecular-weight: |
| − | *** | + | ** 224.17 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[2.5.1.64-RXN]] | |
| − | * | + | * [[ISOCHORSYN-RXN]] |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | + | * [[ISOCHORSYN-RXN]] | |
| − | {{#set: common-name= | + | == Reaction(s) of unknown directionality == |
| − | {{#set: | + | {{#set: common-name=isochorismate}} |
| − | + | {{#set: inchi-key=inchikey=ntgwprccoqcmge-yumqzzprsa-l}} | |
| − | {{#set: | + | {{#set: molecular-weight=224.17}} |
| − | |||
| − | |||
| − | |||
Revision as of 20:36, 18 December 2020
Contents
Metabolite ISOCHORISMATE
- common-name:
- isochorismate
- smiles:
- c=c(c(=o)[o-])oc1(c=cc=c(c1o)c([o-])=o)
- inchi-key:
- ntgwprccoqcmge-yumqzzprsa-l
- molecular-weight:
- 224.17
