Difference between revisions of "O-UREIDOHOMOSERINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9865 == * common-name: ** 6-(all-trans-decaprenyl)-2-methoxy-phenol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=...")
(Created page with "Category:metabolite == Metabolite trans-2-cis-5-dienoyl-CoA == * common-name: ** a (2e,5z)-alkan-2,5-dienoyl-coa == Reaction(s) known to consume the compound == * RXN-12...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9865 ==
+
== Metabolite trans-2-cis-5-dienoyl-CoA ==
 
* common-name:
 
* common-name:
** 6-(all-trans-decaprenyl)-2-methoxy-phenol
+
** a (2e,5z)-alkan-2,5-dienoyl-coa
* smiles:
 
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(oc)c=cc=1))c)c)c)c)c)c)c)c)c)c
 
* inchi-key:
 
** fyllwsgfaaqkhu-gbbrockzsa-n
 
* molecular-weight:
 
** 805.321
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12519]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9233]]
+
* [[RXN-12518]]
 +
* [[RXN-12519]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-(all-trans-decaprenyl)-2-methoxy-phenol}}
+
{{#set: common-name=a (2e,5z)-alkan-2,5-dienoyl-coa}}
{{#set: inchi-key=inchikey=fyllwsgfaaqkhu-gbbrockzsa-n}}
 
{{#set: molecular-weight=805.321}}
 

Revision as of 18:54, 14 January 2021

Metabolite trans-2-cis-5-dienoyl-CoA

  • common-name:
    • a (2e,5z)-alkan-2,5-dienoyl-coa

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality