Difference between revisions of "O-phospho-L-seryl-tRNASecs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8165 == * common-name: ** 1-18:2-2-18:2-monogalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))...")
(Created page with "Category:metabolite == Metabolite CPD-17396 == * common-name: ** a [glycerolipid]-ricinoleate == Reaction(s) known to consume the compound == * RXN-16149 * RXN-16151...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8165 ==
+
== Metabolite CPD-17396 ==
 
* common-name:
 
* common-name:
** 1-18:2-2-18:2-monogalactosyldiacylglycerol
+
** a [glycerolipid]-ricinoleate
* smiles:
 
** cccccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))oc(=o)cccccccc=ccc=cccccc)=o
 
* inchi-key:
 
** broompuvdptgeg-rhnbirjrsa-n
 
* molecular-weight:
 
** 779.105
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8366]]
+
* [[RXN-16149]]
* [[RXN-8367]]
+
* [[RXN-16151]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-16151]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:2-2-18:2-monogalactosyldiacylglycerol}}
+
{{#set: common-name=a [glycerolipid]-ricinoleate}}
{{#set: inchi-key=inchikey=broompuvdptgeg-rhnbirjrsa-n}}
 
{{#set: molecular-weight=779.105}}
 

Revision as of 13:10, 14 January 2021

Metabolite CPD-17396

  • common-name:
    • a [glycerolipid]-ricinoleate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glycerolipid]-ricinoleate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.