Difference between revisions of "OCTADEC-9-ENE-118-DIOIC-ACID"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ14827 == * transcription-direction: ** positive * right-end-position: ** 37271 * left-end-position: ** 24783 * centisome-position: ** 6.1753097...")
(Created page with "Category:metabolite == Metabolite OCTADEC-9-ENE-118-DIOIC-ACID == * common-name: ** α,ω-9z-octadecenedioate * smiles: ** c(=o)([o-])cccccccc=ccccccccc(=o)[o-]...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ14827 ==
+
== Metabolite OCTADEC-9-ENE-118-DIOIC-ACID ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** α,ω-9z-octadecenedioate
−
* right-end-position:
+
* smiles:
−
** 37271
+
** c(=o)([o-])cccccccc=ccccccccc(=o)[o-]
−
* left-end-position:
+
* inchi-key:
−
** 24783
+
** sblkviqsiheqof-uphrsurjsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 6.1753097   
+
** 310.433
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-16418]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[GLUCONOKIN-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=α,ω-9z-octadecenedioate}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=sblkviqsiheqof-uphrsurjsa-l}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=310.433}}
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-5530]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[IDNCAT-PWY]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[GLUCONSUPER-PWY]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=37271}}
 
−
{{#set: left-end-position=24783}}
 
−
{{#set: centisome-position=6.1753097    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=3}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite OCTADEC-9-ENE-118-DIOIC-ACID

  • common-name:
    • α,ω-9z-octadecenedioate
  • smiles:
    • c(=o)([o-])cccccccc=ccccccccc(=o)[o-]
  • inchi-key:
    • sblkviqsiheqof-uphrsurjsa-l
  • molecular-weight:
    • 310.433

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=OCTADEC-9-ENE-118-DIOIC-ACID&oldid=137047"