Difference between revisions of "OCTADEC-9-ENE-118-DIOIC-ACID"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD3DJ-82 == * common-name: ** a dihydroceramide == Reaction(s) known to consume the compound == * RXN-7796 == Reaction(s) known to p...") |
(Created page with "Category:metabolite == Metabolite OCTADEC-9-ENE-118-DIOIC-ACID == * common-name: ** α,ω-9z-octadecenedioate * smiles: ** c(=o)([o-])cccccccc=ccccccccc(=o)[o-]...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite OCTADEC-9-ENE-118-DIOIC-ACID == |
* common-name: | * common-name: | ||
| − | ** | + | ** α,ω-9z-octadecenedioate |
| + | * smiles: | ||
| + | ** c(=o)([o-])cccccccc=ccccccccc(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** sblkviqsiheqof-uphrsurjsa-l | ||
| + | * molecular-weight: | ||
| + | ** 310.433 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-16418]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=α,ω-9z-octadecenedioate}} |
| + | {{#set: inchi-key=inchikey=sblkviqsiheqof-uphrsurjsa-l}} | ||
| + | {{#set: molecular-weight=310.433}} | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite OCTADEC-9-ENE-118-DIOIC-ACID
- common-name:
- α,ω-9z-octadecenedioate
- smiles:
- c(=o)([o-])cccccccc=ccccccccc(=o)[o-]
- inchi-key:
- sblkviqsiheqof-uphrsurjsa-l
- molecular-weight:
- 310.433
