Difference between revisions of "OCTADEC-9-ENE-118-DIOIC-ACID"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17324 == * common-name: ** 3-oxo adrenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=...")
(Created page with "Category:metabolite == Metabolite OCTADEC-9-ENE-118-DIOIC-ACID == * common-name: ** α,ω-9z-octadecenedioate * smiles: ** c(=o)([o-])cccccccc=ccccccccc(=o)[o-]...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-17324 ==
+
== Metabolite OCTADEC-9-ENE-118-DIOIC-ACID ==
 
* common-name:
 
* common-name:
−
** 3-oxo adrenoyl-coa
+
** α,ω-9z-octadecenedioate
 
* smiles:
 
* smiles:
−
** cccccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(=o)([o-])cccccccc=ccccccccc(=o)[o-]
 
* inchi-key:
 
* inchi-key:
−
** vmajwsswcpbijy-kpovblhlsa-j
+
** sblkviqsiheqof-uphrsurjsa-l
 
* molecular-weight:
 
* molecular-weight:
−
** 1091.996
+
** 310.433
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-16112]]
+
* [[RXN-16418]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=3-oxo adrenoyl-coa}}
+
{{#set: common-name=α,ω-9z-octadecenedioate}}
−
{{#set: inchi-key=inchikey=vmajwsswcpbijy-kpovblhlsa-j}}
+
{{#set: inchi-key=inchikey=sblkviqsiheqof-uphrsurjsa-l}}
−
{{#set: molecular-weight=1091.996}}
+
{{#set: molecular-weight=310.433}}

Latest revision as of 11:11, 18 March 2021

Metabolite OCTADEC-9-ENE-118-DIOIC-ACID

  • common-name:
    • α,ω-9z-octadecenedioate
  • smiles:
    • c(=o)([o-])cccccccc=ccccccccc(=o)[o-]
  • inchi-key:
    • sblkviqsiheqof-uphrsurjsa-l
  • molecular-weight:
    • 310.433

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=OCTADEC-9-ENE-118-DIOIC-ACID&oldid=137047"