Difference between revisions of "OCTADEC-9-ENE-118-DIOIC-ACID"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17324 == * common-name: ** 3-oxo adrenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=...")
(Created page with "Category:metabolite == Metabolite CPD-11540 == * common-name: ** udp-4-dehydro-β-l-rhamnose * smiles: ** cc3(c(=o)c(o)c(o)c(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17324 ==
+
== Metabolite CPD-11540 ==
 
* common-name:
 
* common-name:
** 3-oxo adrenoyl-coa
+
** udp-4-dehydro-β-l-rhamnose
 
* smiles:
 
* smiles:
** cccccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc3(c(=o)c(o)c(o)c(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)o3)
 
* inchi-key:
 
* inchi-key:
** vmajwsswcpbijy-kpovblhlsa-j
+
** ddwgqqadoimfoi-tyenrrdnsa-l
 
* molecular-weight:
 
* molecular-weight:
** 1091.996
+
** 546.274
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16112]]
+
* [[RXN-10740]]
 +
* [[RXN-18332]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-18332]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo adrenoyl-coa}}
+
{{#set: common-name=udp-4-dehydro-β-l-rhamnose}}
{{#set: inchi-key=inchikey=vmajwsswcpbijy-kpovblhlsa-j}}
+
{{#set: inchi-key=inchikey=ddwgqqadoimfoi-tyenrrdnsa-l}}
{{#set: molecular-weight=1091.996}}
+
{{#set: molecular-weight=546.274}}

Revision as of 13:08, 14 January 2021

Metabolite CPD-11540

  • common-name:
    • udp-4-dehydro-β-l-rhamnose
  • smiles:
    • cc3(c(=o)c(o)c(o)c(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)o3)
  • inchi-key:
    • ddwgqqadoimfoi-tyenrrdnsa-l
  • molecular-weight:
    • 546.274

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality