Difference between revisions of "OCTANOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite THIAMINE == * common-name: ** thiamine * smiles: ** cc1([n+](=csc(cco)=1)cc2(c=nc(c)=nc(n)=2)) * inchi-key: ** jzrwcgzrtzmzeh-uhfffaoysa-...") |
(Created page with "Category:metabolite == Metabolite OCTANOL == * common-name: ** 1-octanol * smiles: ** cccccccco * inchi-key: ** kbplfhhgfootca-uhfffaoysa-n * molecular-weight: ** 130.23 =...") |
||
| (5 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite OCTANOL == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-octanol |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccccco |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** kbplfhhgfootca-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 130.23 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ALKANE-1-MONOOXYGENASE-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-octanol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kbplfhhgfootca-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=130.23}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite OCTANOL
- common-name:
- 1-octanol
- smiles:
- cccccccco
- inchi-key:
- kbplfhhgfootca-uhfffaoysa-n
- molecular-weight:
- 130.23
