Difference between revisions of "OCTAPRENYL-DIPHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Fatty-Acids == * common-name: ** a fatty acid == Reaction(s) known to consume the compound == * BUTYRATE--COA-LIGASE-RXN == Reaction(...") |
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-DIPHOSPHATE == * common-name: ** all-trans-octaprenyl diphosphate * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite OCTAPRENYL-DIPHOSPHATE == |
* common-name: | * common-name: | ||
− | ** | + | ** all-trans-octaprenyl diphosphate |
+ | * smiles: | ||
+ | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-] | ||
+ | * inchi-key: | ||
+ | ** ikkldissulffqo-djmiluhssa-k | ||
+ | * molecular-weight: | ||
+ | ** 719.897 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=all-trans-octaprenyl diphosphate}} |
+ | {{#set: inchi-key=inchikey=ikkldissulffqo-djmiluhssa-k}} | ||
+ | {{#set: molecular-weight=719.897}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite OCTAPRENYL-DIPHOSPHATE
- common-name:
- all-trans-octaprenyl diphosphate
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
- inchi-key:
- ikkldissulffqo-djmiluhssa-k
- molecular-weight:
- 719.897