Difference between revisions of "OCTAPRENYL-DIPHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ21400 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-DIPHOSPHATE == * common-name: ** all-trans-octaprenyl diphosphate * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=c...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite OCTAPRENYL-DIPHOSPHATE == |
− | == | + | * common-name: |
− | + | ** all-trans-octaprenyl diphosphate | |
− | == | + | * smiles: |
− | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-] | |
− | * | + | * inchi-key: |
− | ** | + | ** ikkldissulffqo-djmiluhssa-k |
− | * | + | * molecular-weight: |
− | + | ** 719.897 | |
− | ** | + | == Reaction(s) known to consume the compound == |
− | == | + | * [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | {{#set: | + | {{#set: common-name=all-trans-octaprenyl diphosphate}} |
− | {{#set: | + | {{#set: inchi-key=inchikey=ikkldissulffqo-djmiluhssa-k}} |
− | {{#set: | + | {{#set: molecular-weight=719.897}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite OCTAPRENYL-DIPHOSPHATE
- common-name:
- all-trans-octaprenyl diphosphate
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
- inchi-key:
- ikkldissulffqo-djmiluhssa-k
- molecular-weight:
- 719.897