Difference between revisions of "OCTAPRENYL-DIPHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ21859 == * transcription-direction: ** negative * right-end-position: ** 141374 * left-end-position: ** 130906 * centisome-position: ** 70.79788...")
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-DIPHOSPHATE == * common-name: ** all-trans-octaprenyl diphosphate * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=c...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ21859 ==
+
== Metabolite OCTAPRENYL-DIPHOSPHATE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** all-trans-octaprenyl diphosphate
−
* right-end-position:
+
* smiles:
−
** 141374
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
−
* left-end-position:
+
* inchi-key:
−
** 130906
+
** ikkldissulffqo-djmiluhssa-k
−
* centisome-position:
+
* molecular-weight:
−
** 70.79788   
+
** 719.897
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) of unknown directionality ==
−
* [[ARACHIDONATE-15-LIPOXYGENASE-RXN]]
+
{{#set: common-name=all-trans-octaprenyl diphosphate}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=ikkldissulffqo-djmiluhssa-k}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=719.897}}
−
* [[ARACHIDONATE-5-LIPOXYGENASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-1321]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-13395]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-8497]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-8647]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY66-375]]
 
−
** '''5''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-5410]]
 
−
** '''2''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-735]]
 
−
** '''16''' reactions found over '''19''' reactions in the full pathway
 
−
* [[PWY66-392]]
 
−
** '''1''' reactions found over '''11''' reactions in the full pathway
 
−
* [[PWY-6917]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-5406]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-5407]]
 
−
** '''1''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-5408]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=141374}}
 
−
{{#set: left-end-position=130906}}
 
−
{{#set: centisome-position=70.79788    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=6}}
 
−
{{#set: nb pathway associated=8}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite OCTAPRENYL-DIPHOSPHATE

  • common-name:
    • all-trans-octaprenyl diphosphate
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
  • inchi-key:
    • ikkldissulffqo-djmiluhssa-k
  • molecular-weight:
    • 719.897

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=OCTAPRENYL-DIPHOSPHATE&oldid=137146"