Difference between revisions of "OCTAPRENYL-DIPHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TRIPEPTIDES == * common-name: ** a tripeptide == Reaction(s) known to consume the compound == * 3.4.11.4-RXN == Reaction(s) known to...") |
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-DIPHOSPHATE == * common-name: ** all-trans-octaprenyl diphosphate * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=c...") |
||
| (3 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite OCTAPRENYL-DIPHOSPHATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** all-trans-octaprenyl diphosphate |
| + | * smiles: | ||
| + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-] | ||
| + | * inchi-key: | ||
| + | ** ikkldissulffqo-djmiluhssa-k | ||
| + | * molecular-weight: | ||
| + | ** 719.897 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=all-trans-octaprenyl diphosphate}} |
| + | {{#set: inchi-key=inchikey=ikkldissulffqo-djmiluhssa-k}} | ||
| + | {{#set: molecular-weight=719.897}} | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite OCTAPRENYL-DIPHOSPHATE
- common-name:
- all-trans-octaprenyl diphosphate
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
- inchi-key:
- ikkldissulffqo-djmiluhssa-k
- molecular-weight:
- 719.897
