Difference between revisions of "OCTAPRENYL-METHOXY-BENZOQUINONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.3.43-RXN 3.1.3.43-RXN] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.o...")
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-METHOXY-BENZOQUINONE == * common-name: ** 2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=cccc(=cccc(=...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.3.43-RXN 3.1.3.43-RXN] ==
+
== Metabolite OCTAPRENYL-METHOXY-BENZOQUINONE ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** 2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.1.3.43 ec-3.1.3.43]
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c)c)c
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[Pyruvate-Dehydrogenase-Phosphoserine]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[Pyruvate-dehydrogenase-L-serine]][c]
+
** czfrmaseeptbaq-mycgwmctsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ11483]]
+
** 685.084
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol}}
−
== External links  ==
+
{{#set: inchi-key=inchikey=czfrmaseeptbaq-mycgwmctsa-n}}
−
* LIGAND-RXN:
+
{{#set: molecular-weight=685.084}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R03450 R03450]
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/P35816 P35816]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: ec-number=ec-3.1.3.43}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite OCTAPRENYL-METHOXY-BENZOQUINONE

  • common-name:
    • 2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c)c)c
  • inchi-key:
    • czfrmaseeptbaq-mycgwmctsa-n
  • molecular-weight:
    • 685.084

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=OCTAPRENYL-METHOXY-BENZOQUINONE&oldid=139621"