Difference between revisions of "OCTAPRENYL-METHOXY-BENZOQUINONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-787 == * common-name: ** (2z,4z)-2-hydroxyhepta-2,4-dienedioate * smiles: ** c([o-])(=o)cc=cc=c(o)c(=o)[o-] * inchi-key: ** zbcbetmbs...")
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-METHOXY-BENZOQUINONE == * common-name: ** 2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=cccc(=cccc(=...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-787 ==
+
== Metabolite OCTAPRENYL-METHOXY-BENZOQUINONE ==
 
* common-name:
 
* common-name:
** (2z,4z)-2-hydroxyhepta-2,4-dienedioate
+
** 2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol
 
* smiles:
 
* smiles:
** c([o-])(=o)cc=cc=c(o)c(=o)[o-]
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** zbcbetmbsdtinl-nwjcxacmsa-l
+
** czfrmaseeptbaq-mycgwmctsa-n
 
* molecular-weight:
 
* molecular-weight:
** 170.121
+
** 685.084
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN1K-87]]
+
* [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2z,4z)-2-hydroxyhepta-2,4-dienedioate}}
+
{{#set: common-name=2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol}}
{{#set: inchi-key=inchikey=zbcbetmbsdtinl-nwjcxacmsa-l}}
+
{{#set: inchi-key=inchikey=czfrmaseeptbaq-mycgwmctsa-n}}
{{#set: molecular-weight=170.121}}
+
{{#set: molecular-weight=685.084}}

Latest revision as of 11:17, 18 March 2021

Metabolite OCTAPRENYL-METHOXY-BENZOQUINONE

  • common-name:
    • 2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c)c)c
  • inchi-key:
    • czfrmaseeptbaq-mycgwmctsa-n
  • molecular-weight:
    • 685.084

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality