Difference between revisions of "OCTAPRENYL-METHOXY-BENZOQUINONE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MANNKIN-RXN-CPD-12601/ATP//MANNOSE-6P/ADP/PROTON.37. MANNKIN-RXN-CPD-12601/ATP//MANNOSE-6P/ADP/PROT...") |
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-METHOXY-BENZOQUINONE == * common-name: ** 2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=cccc(=cccc(=...") |
||
(7 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite OCTAPRENYL-METHOXY-BENZOQUINONE == |
− | * | + | * common-name: |
− | ** | + | ** 2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol |
− | == Reaction | + | * smiles: |
− | * | + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c)c)c |
− | == | + | * inchi-key: |
− | == | + | ** czfrmaseeptbaq-mycgwmctsa-n |
− | + | * molecular-weight: | |
− | + | ** 685.084 | |
− | + | == Reaction(s) known to consume the compound == | |
− | {{#set: | + | * [[2-OCTAPRENYL-METHOXY-BENZOQ-METH-RXN]] |
− | {{#set: | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | {{#set: | + | {{#set: common-name=2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol}} |
− | + | {{#set: inchi-key=inchikey=czfrmaseeptbaq-mycgwmctsa-n}} | |
− | + | {{#set: molecular-weight=685.084}} | |
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite OCTAPRENYL-METHOXY-BENZOQUINONE
- common-name:
- 2-methoxy-6-all trans-octaprenyl-1,4-benzoquinol
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c)c)c
- inchi-key:
- czfrmaseeptbaq-mycgwmctsa-n
- molecular-weight:
- 685.084