Difference between revisions of "OCTAPRENYL-METHYL-OH-METHOXY-BENZQ"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CYS-tRNAs == * common-name: ** a trnacys == Reaction(s) known to consume the compound == * CYSTEINE--TRNA-LIGASE-RXN == Reaction(s) k...")
(Created page with "Category:metabolite == Metabolite CPD-9894 == * common-name: ** 3,4-dihydroxy-5-all-trans-octaprenylbenzoate * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CYS-tRNAs ==
+
== Metabolite CPD-9894 ==
 
* common-name:
 
* common-name:
** a trnacys
+
** 3,4-dihydroxy-5-all-trans-octaprenylbenzoate
 +
* smiles:
 +
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c)c)c
 +
* inchi-key:
 +
** ztgcmypriiaxfd-lhsbzcsksa-m
 +
* molecular-weight:
 +
** 698.06
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CYSTEINE--TRNA-LIGASE-RXN]]
+
* [[RXN-9280]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16637]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a trnacys}}
+
{{#set: common-name=3,4-dihydroxy-5-all-trans-octaprenylbenzoate}}
 +
{{#set: inchi-key=inchikey=ztgcmypriiaxfd-lhsbzcsksa-m}}
 +
{{#set: molecular-weight=698.06}}

Revision as of 08:31, 15 March 2021

Metabolite CPD-9894

  • common-name:
    • 3,4-dihydroxy-5-all-trans-octaprenylbenzoate
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c)c)c
  • inchi-key:
    • ztgcmypriiaxfd-lhsbzcsksa-m
  • molecular-weight:
    • 698.06

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality