Difference between revisions of "OCTAPRENYL-METHYL-OH-METHOXY-BENZQ"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CYS-tRNAs == * common-name: ** a trnacys == Reaction(s) known to consume the compound == * CYSTEINE--TRNA-LIGASE-RXN == Reaction(s) k...") |
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-METHYL-OH-METHOXY-BENZQ == * common-name: ** 3-demethylubiquinol-8 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite OCTAPRENYL-METHYL-OH-METHOXY-BENZQ == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-demethylubiquinol-8 |
| + | * smiles: | ||
| + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(o)c(o)=c(c)1) | ||
| + | * inchi-key: | ||
| + | ** qurlimhpcrkmjp-wdxiliiosa-n | ||
| + | * molecular-weight: | ||
| + | ** 715.11 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[DHHB-METHYLTRANSFER-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-demethylubiquinol-8}} |
| + | {{#set: inchi-key=inchikey=qurlimhpcrkmjp-wdxiliiosa-n}} | ||
| + | {{#set: molecular-weight=715.11}} | ||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite OCTAPRENYL-METHYL-OH-METHOXY-BENZQ
- common-name:
- 3-demethylubiquinol-8
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(o)c(o)=c(c)1)
- inchi-key:
- qurlimhpcrkmjp-wdxiliiosa-n
- molecular-weight:
- 715.11
