Difference between revisions of "OCTAPRENYL-METHYL-OH-METHOXY-BENZQ"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16425 RXN-16425] == * direction: ** left-to-right == Reaction formula == * 1 N-ACETYL-D-GLUCO...") |
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-METHYL-OH-METHOXY-BENZQ == * common-name: ** 3-demethylubiquinol-8 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite OCTAPRENYL-METHYL-OH-METHOXY-BENZQ == |
− | * | + | * common-name: |
− | ** | + | ** 3-demethylubiquinol-8 |
− | == | + | * smiles: |
− | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(o)c(o)=c(c)1) | |
− | == | + | * inchi-key: |
− | * | + | ** qurlimhpcrkmjp-wdxiliiosa-n |
− | ** | + | * molecular-weight: |
− | + | ** 715.11 | |
− | * | + | == Reaction(s) known to consume the compound == |
− | ** | + | * [[DHHB-METHYLTRANSFER-RXN]] |
− | == | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | {{#set: common-name=3-demethylubiquinol-8}} |
− | + | {{#set: inchi-key=inchikey=qurlimhpcrkmjp-wdxiliiosa-n}} | |
− | == | + | {{#set: molecular-weight=715.11}} |
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite OCTAPRENYL-METHYL-OH-METHOXY-BENZQ
- common-name:
- 3-demethylubiquinol-8
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(o)c(oc)=c(o)c(o)=c(c)1)
- inchi-key:
- qurlimhpcrkmjp-wdxiliiosa-n
- molecular-weight:
- 715.11