Difference between revisions of "OCTOPINEDEG-PWY"

Revision as of 09:22, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLLIDE-A CHLOROPHYLLIDE-A] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYINOSINE DEOXYINOSINE] ==
+* common-name:
+** 2'-deoxyinosine
 * smiles:
-** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(cc)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
+** c(o)c1(oc(cc(o)1)n3(c=nc2(=c(o)n=cn=c23)))
-* common-name:
+* inchi-key:
-** chlorophyllide a
+** vgontnsxdcqugy-rrkcrqdmsa-n
 * molecular-weight:
-** 612.967
+** 252.229
 == Reaction(s) known to consume the compound ==
-* [[RXN-13398]]
+* [[DEOXYINOPHOSPHOR-RXN]]
-* [[RXN-7663]]
-* [[RXN-7676]]
-* [[RXN1F-66]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-5286]]
+* [[ADDALT-RXN]]
-* [[RXN1F-10]]
+* [[DEOXYINOPHOSPHOR-RXN]]
-* [[RXN1F-66]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=chlorophyllide a}}
+{{#set: common-name=2'-deoxyinosine}}
-{{#set: molecular-weight=612.967}}
+{{#set: inchi-key=inchikey=vgontnsxdcqugy-rrkcrqdmsa-n}}
+{{#set: molecular-weight=252.229}}