Difference between revisions of "OH-ACYL-ACP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite FADH2 == * common-name: ** fadh2 * smiles: ** cc1(=c(c)c=c2(n(c3(nc(nc(=o)c(nc(=c1)2)=3)=o))cc(o)c(o)c(o)cop(op([o-])(occ6(c(o)c(o)c(n5(c...")
(Created page with "Category:metabolite == Metabolite OH-ACYL-ACP == * common-name: ** a (3r)-3-hydroxyacyl-[acyl-carrier protein] == Reaction(s) known to consume the compound == * 3-HYDROX...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite FADH2 ==
+
== Metabolite OH-ACYL-ACP ==
 
* common-name:
 
* common-name:
** fadh2
+
** a (3r)-3-hydroxyacyl-[acyl-carrier protein]
* smiles:
 
** cc1(=c(c)c=c2(n(c3(nc(nc(=o)c(nc(=c1)2)=3)=o))cc(o)c(o)c(o)cop(op([o-])(occ6(c(o)c(o)c(n5(c=nc4(c(n)=nc=nc=45)))o6))=o)([o-])=o))
 
* inchi-key:
 
** ypzrhbjkemoyqh-uybvjogssa-l
 
* molecular-weight:
 
** 785.556
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACOAD1f]]
+
* [[3-HYDROXYDECANOYL-ACP-DEHYDR-RXN]]
* [[PPCOAOm]]
 
* [[RXN-14264]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACOA120OR]]
+
* [[3-OXOACYL-ACP-REDUCT-RXN]]
* [[ACOA140OR]]
 
* [[ACOA160OR]]
 
* [[ACOA40OR]]
 
* [[ACOA80OR]]
 
* [[ACOAD1f]]
 
* [[IVCDH]]
 
* [[MCDH]]
 
* [[MCDH_LPAREN_2mb2coa_RPAREN_]]
 
* [[PPCOAOm]]
 
* [[RXN-14264]]
 
* [[SUCDHm]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=fadh2}}
+
{{#set: common-name=a (3r)-3-hydroxyacyl-[acyl-carrier protein]}}
{{#set: inchi-key=inchikey=ypzrhbjkemoyqh-uybvjogssa-l}}
 
{{#set: molecular-weight=785.556}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite OH-ACYL-ACP

  • common-name:
    • a (3r)-3-hydroxyacyl-[acyl-carrier protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (3r)-3-hydroxyacyl-[acyl-carrier protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.