Difference between revisions of "OH-ACYL-ACP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ06735 == * transcription-direction: ** positive * right-end-position: ** 71918 * left-end-position: ** 39016 * centisome-position: ** 51.415997...")
(Created page with "Category:metabolite == Metabolite CPD-11529 == * common-name: ** (+)-7-epi-jasmonoyl-coa * smiles: ** ccc=ccc1(c(=o)ccc1cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ06735 ==
+
== Metabolite CPD-11529 ==
* transcription-direction:
+
* common-name:
** positive
+
** (+)-7-epi-jasmonoyl-coa
* right-end-position:
+
* smiles:
** 71918
+
** ccc=ccc1(c(=o)ccc1cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
* left-end-position:
+
* inchi-key:
** 39016
+
** wqkkcppndksaiu-cbgydujusa-j
* centisome-position:
+
* molecular-weight:
** 51.415997   
+
** 955.76
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-10708]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
+
* [[RXN-10701]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=(+)-7-epi-jasmonoyl-coa}}
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=wqkkcppndksaiu-cbgydujusa-j}}
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=955.76}}
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=71918}}
 
{{#set: left-end-position=39016}}
 
{{#set: centisome-position=51.415997    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Revision as of 20:31, 18 December 2020

Metabolite CPD-11529

  • common-name:
    • (+)-7-epi-jasmonoyl-coa
  • smiles:
    • ccc=ccc1(c(=o)ccc1cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])=o)
  • inchi-key:
    • wqkkcppndksaiu-cbgydujusa-j
  • molecular-weight:
    • 955.76

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality