|
|
| (7 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ15200 == | + | == Metabolite OH-HEXANOYL-COA == |
| − | * transcription-direction: | + | * common-name: |
| − | ** positive | + | ** (s)-3-hydroxyhexanoyl-coa |
| − | * right-end-position:
| + | * smiles: |
| − | ** 705415
| + | ** cccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o |
| − | * left-end-position:
| + | * inchi-key: |
| − | ** 687168 | + | ** vaahkrmgofiorx-dwufxmdisa-j |
| − | * centisome-position:
| + | * molecular-weight: |
| − | ** 97.133766 | + | ** 877.646 |
| − | == Organism(s) associated with this gene == | + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]]
| + | * [[ECOAH2h]] |
| − | == Reaction(s) associated == | + | * [[HACD2h]] |
| − | * [[DXS-RXN]]
| + | * [[RXN-12567]] |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to produce the compound == |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | + | * [[ECOAH2h]] |
| − | ** Category: [[orthology]]
| + | * [[HACD2h]] |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| + | * [[RXN-12570]] |
| − | *** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| + | == Reaction(s) of unknown directionality == |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| + | {{#set: common-name=(s)-3-hydroxyhexanoyl-coa}} |
| − | * [[PYFLAVOXRE-RXN]]
| + | {{#set: inchi-key=inchikey=vaahkrmgofiorx-dwufxmdisa-j}} |
| − | ** Category: [[orthology]]
| + | {{#set: molecular-weight=877.646}} |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | * [[PYRUFLAVREDUCT-RXN]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | == Pathway(s) associated == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * [[PWY-6891]] | |
| − | ** '''4''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-6892]] | |
| − | ** '''5''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PYRIDOXSYN-PWY]] | |
| − | ** '''3''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[NONMEVIPP-PWY]]
| |
| − | ** '''9''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-7560]] | |
| − | ** '''9''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[NPGLUCAT-PWY]] | |
| − | ** '''4''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-5493]] | |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-6863]]
| |
| − | ** '''9''' reactions found over '''11''' reactions in the full pathway
| |
| − | * [[PWY-6587]]
| |
| − | ** '''2''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-6588]]
| |
| − | ** '''2''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-5497]]
| |
| − | ** '''10''' reactions found over '''24''' reactions in the full pathway
| |
| − | * [[PWY-6583]]
| |
| − | ** '''6''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-5483]]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[CENTFERM-PWY]]
| |
| − | ** '''5''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[P42-PWY]]
| |
| − | ** '''5''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-5392]]
| |
| − | ** '''6''' reactions found over '''12''' reactions in the full pathway
| |
| − | * [[P142-PWY]]
| |
| − | ** '''2''' reactions found over '''1''' reactions in the full pathway
| |
| − | * [[GLUDEG-II-PWY]]
| |
| − | ** '''3''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-6142]]
| |
| − | ** '''10''' reactions found over '''13''' reactions in the full pathway
| |
| − | * [[PWY-5538]]
| |
| − | ** '''2''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[P23-PWY]]
| |
| − | ** '''9''' reactions found over '''12''' reactions in the full pathway
| |
| − | * [[PWY-6876]]
| |
| − | ** '''2''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-5600]]
| |
| − | ** '''2''' reactions found over '''1''' reactions in the full pathway
| |
| − | </div>
| |
| − | {{#set: transcription-direction=positive}} | |
| − | {{#set: right-end-position=705415}} | |
| − | {{#set: left-end-position=687168}}
| |
| − | {{#set: centisome-position=97.133766 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}}
| |
| − | {{#set: nb reaction associated=3}}
| |
| − | {{#set: nb pathway associated=23}}
| |
