Difference between revisions of "OH-HEXANOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite D-2-hydroxyacids == * common-name: ** an (r)-2-hydroxycarboxylate == Reaction(s) known to consume the compound == * 1.1.1.272-RXN ==...")
(Created page with "Category:metabolite == Metabolite OH-HEXANOYL-COA == * common-name: ** (s)-3-hydroxyhexanoyl-coa * smiles: ** cccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite D-2-hydroxyacids ==
+
== Metabolite OH-HEXANOYL-COA ==
 
* common-name:
 
* common-name:
** an (r)-2-hydroxycarboxylate
+
** (s)-3-hydroxyhexanoyl-coa
 +
* smiles:
 +
** cccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
 +
* inchi-key:
 +
** vaahkrmgofiorx-dwufxmdisa-j
 +
* molecular-weight:
 +
** 877.646
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.1.1.272-RXN]]
+
* [[ECOAH2h]]
 +
* [[HACD2h]]
 +
* [[RXN-12567]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.272-RXN]]
+
* [[ECOAH2h]]
 +
* [[HACD2h]]
 +
* [[RXN-12570]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an (r)-2-hydroxycarboxylate}}
+
{{#set: common-name=(s)-3-hydroxyhexanoyl-coa}}
 +
{{#set: inchi-key=inchikey=vaahkrmgofiorx-dwufxmdisa-j}}
 +
{{#set: molecular-weight=877.646}}

Latest revision as of 11:14, 18 March 2021

Metabolite OH-HEXANOYL-COA

  • common-name:
    • (s)-3-hydroxyhexanoyl-coa
  • smiles:
    • cccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
  • inchi-key:
    • vaahkrmgofiorx-dwufxmdisa-j
  • molecular-weight:
    • 877.646

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality