Difference between revisions of "OH-HEXANOYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ00056 == * transcription-direction: ** negative * right-end-position: ** 956840 * left-end-position: ** 944169 * centisome-position: ** 64.2705...") |
(Created page with "Category:metabolite == Metabolite OH-HEXANOYL-COA == * common-name: ** (s)-3-hydroxyhexanoyl-coa * smiles: ** cccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([...") |
||
| (9 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite OH-HEXANOYL-COA == |
| − | * | + | * common-name: |
| − | ** | + | ** (s)-3-hydroxyhexanoyl-coa |
| − | * | + | * smiles: |
| − | ** | + | ** cccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o |
| − | * | + | * inchi-key: |
| − | ** | + | ** vaahkrmgofiorx-dwufxmdisa-j |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 877.646 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[ECOAH2h]] |
| − | + | * [[HACD2h]] | |
| − | * [[ | + | * [[RXN-12567]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | + | * [[ECOAH2h]] | |
| − | * [[ | + | * [[HACD2h]] |
| − | * | + | * [[RXN-12570]] |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | == | + | {{#set: common-name=(s)-3-hydroxyhexanoyl-coa}} |
| − | + | {{#set: inchi-key=inchikey=vaahkrmgofiorx-dwufxmdisa-j}} | |
| − | + | {{#set: molecular-weight=877.646}} | |
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite OH-HEXANOYL-COA
- common-name:
- (s)-3-hydroxyhexanoyl-coa
- smiles:
- cccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
- inchi-key:
- vaahkrmgofiorx-dwufxmdisa-j
- molecular-weight:
- 877.646
