Difference between revisions of "OH-MYRISTOYL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11876 == * common-name: ** 3-methoxy-4-hydroxyphenylglycolaldehyde * smiles: ** coc1(=c(o)c=cc(c(o)c=o)=c1) * inchi-key: ** visajvapy...")
(Created page with "Category:metabolite == Metabolite OH-MYRISTOYL == * common-name: ** udp-2-n,3-o-bis[(3r)-3-hydroxytetradecanoyl]-α-d-glucosamine * smiles: ** cccccccccccc(cc(nc1(c(c...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11876 ==
+
== Metabolite OH-MYRISTOYL ==
 
* common-name:
 
* common-name:
** 3-methoxy-4-hydroxyphenylglycolaldehyde
+
** udp-2-n,3-o-bis[(3r)-3-hydroxytetradecanoyl]-α-d-glucosamine
 
* smiles:
 
* smiles:
** coc1(=c(o)c=cc(c(o)c=o)=c1)
+
** cccccccccccc(cc(nc1(c(c(c(oc1op(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))co)o)oc(cc(ccccccccccc)o)=o))=o)o
 
* inchi-key:
 
* inchi-key:
** visajvapypfkcl-qmmmgpobsa-n
+
** kojcfmystwnmqw-ruajdyctsa-l
 
* molecular-weight:
 
* molecular-weight:
** 182.176
+
** 1016.021
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10915]]
 
* [[RXN-10917]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10910]]
+
* [[UDPHYDROXYMYRGLUCOSAMNACETYLTRANS-RXN]]
* [[RXN-10913]]
 
* [[RXN-10915]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-methoxy-4-hydroxyphenylglycolaldehyde}}
+
{{#set: common-name=udp-2-n,3-o-bis[(3r)-3-hydroxytetradecanoyl]-α-d-glucosamine}}
{{#set: inchi-key=inchikey=visajvapypfkcl-qmmmgpobsa-n}}
+
{{#set: inchi-key=inchikey=kojcfmystwnmqw-ruajdyctsa-l}}
{{#set: molecular-weight=182.176}}
+
{{#set: molecular-weight=1016.021}}

Latest revision as of 11:13, 18 March 2021

Metabolite OH-MYRISTOYL

  • common-name:
    • udp-2-n,3-o-bis[(3r)-3-hydroxytetradecanoyl]-α-d-glucosamine
  • smiles:
    • cccccccccccc(cc(nc1(c(c(c(oc1op(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))co)o)oc(cc(ccccccccccc)o)=o))=o)o
  • inchi-key:
    • kojcfmystwnmqw-ruajdyctsa-l
  • molecular-weight:
    • 1016.021

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "udp-2-n,3-o-bis[(3r)-3-hydroxytetradecanoyl]-α-d-glucosamine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.