Difference between revisions of "OH-MYRISTOYL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11876 == * common-name: ** 3-methoxy-4-hydroxyphenylglycolaldehyde * smiles: ** coc1(=c(o)c=cc(c(o)c=o)=c1) * inchi-key: ** visajvapy...") |
(Created page with "Category:metabolite == Metabolite OH-MYRISTOYL == * common-name: ** udp-2-n,3-o-bis[(3r)-3-hydroxytetradecanoyl]-α-d-glucosamine * smiles: ** cccccccccccc(cc(nc1(c(c...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite OH-MYRISTOYL == |
* common-name: | * common-name: | ||
− | ** 3- | + | ** udp-2-n,3-o-bis[(3r)-3-hydroxytetradecanoyl]-α-d-glucosamine |
* smiles: | * smiles: | ||
− | ** | + | ** cccccccccccc(cc(nc1(c(c(c(oc1op(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))co)o)oc(cc(ccccccccccc)o)=o))=o)o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** kojcfmystwnmqw-ruajdyctsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 1016.021 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[UDPHYDROXYMYRGLUCOSAMNACETYLTRANS-RXN]] |
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=3- | + | {{#set: common-name=udp-2-n,3-o-bis[(3r)-3-hydroxytetradecanoyl]-α-d-glucosamine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kojcfmystwnmqw-ruajdyctsa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=1016.021}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite OH-MYRISTOYL
- common-name:
- udp-2-n,3-o-bis[(3r)-3-hydroxytetradecanoyl]-α-d-glucosamine
- smiles:
- cccccccccccc(cc(nc1(c(c(c(oc1op(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n3(c=cc(=o)nc(=o)3)))co)o)oc(cc(ccccccccccc)o)=o))=o)o
- inchi-key:
- kojcfmystwnmqw-ruajdyctsa-l
- molecular-weight:
- 1016.021
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "udp-2-n,3-o-bis[(3r)-3-hydroxytetradecanoyl]-α-d-glucosamine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.