Difference between revisions of "OH-PYR"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-ASPARTATE == * common-name: ** l-aspartate * smiles: ** c(c(=o)[o-])c([n+])c(=o)[o-] * inchi-key: ** ckljmwtzizzhcs-reohclbhsa-m * mole...") |
(Created page with "Category:metabolite == Metabolite L-Amino-Acids == * common-name: ** an l-amino acid == Reaction(s) known to consume the compound == * ALANINE--OXO-ACID-AMINOTRANSFERASE...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite L- | + | == Metabolite L-Amino-Acids == |
* common-name: | * common-name: | ||
| − | ** l- | + | ** an l-amino acid |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ALANINE--OXO-ACID-AMINOTRANSFERASE-RXN]] |
| − | + | * [[AMINO-ACID-RACEMASE-RXN]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ALANINE--OXO-ACID-AMINOTRANSFERASE-RXN]] |
| − | + | * [[AMINO-ACID-RACEMASE-RXN]] | |
| − | + | * [[CARBOXYPEPTIDASE-A-RXN]] | |
| − | * [[ | + | * [[GAMMA-GLUTAMYLCYCLOTRANSFERASE-RXN]] |
| − | |||
| − | |||
| − | * [[ | ||
| − | * [[ | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=l- | + | {{#set: common-name=an l-amino acid}} |
| − | |||
| − | |||
Revision as of 08:25, 15 March 2021
Contents
Metabolite L-Amino-Acids
- common-name:
- an l-amino acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- ALANINE--OXO-ACID-AMINOTRANSFERASE-RXN
- AMINO-ACID-RACEMASE-RXN
- CARBOXYPEPTIDASE-A-RXN
- GAMMA-GLUTAMYLCYCLOTRANSFERASE-RXN
