Difference between revisions of "OH-PYR"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-ASPARTATE == * common-name: ** l-aspartate * smiles: ** c(c(=o)[o-])c([n+])c(=o)[o-] * inchi-key: ** ckljmwtzizzhcs-reohclbhsa-m * mole...") |
(Created page with "Category:metabolite == Metabolite OH-PYR == * common-name: ** hydroxypyruvate * smiles: ** c(c(=o)c([o-])=o)o * inchi-key: ** hhddccuiiuwngj-uhfffaoysa-m * molecular-weigh...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite OH-PYR == |
* common-name: | * common-name: | ||
− | ** | + | ** hydroxypyruvate |
* smiles: | * smiles: | ||
− | ** c(c(=o)[o-]) | + | ** c(c(=o)c([o-])=o)o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** hhddccuiiuwngj-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 103.054 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[HYDROXYPYRUVATE-REDUCTASE-RXN]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[HYDROXYPYRUVATE-REDUCTASE-RXN]] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=hydroxypyruvate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hhddccuiiuwngj-uhfffaoysa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=103.054}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite OH-PYR
- common-name:
- hydroxypyruvate
- smiles:
- c(c(=o)c([o-])=o)o
- inchi-key:
- hhddccuiiuwngj-uhfffaoysa-m
- molecular-weight:
- 103.054