Difference between revisions of "OHyW-58-tRNAPhe"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12762 == * common-name: ** (2e,4e,6e)-2,6-dimethylocta-2,4,6-trienedial * smiles: ** cc(=cc=o)c=cc=c(c=o)c * inchi-key: ** ppjgvkzrxc...")
(Created page with "Category:metabolite == Metabolite UROPORPHYRINOGEN-III == * common-name: ** uroporphyrinogen-iii * smiles: ** c(=o)([o-])ccc3(c(=c2(cc5(nc(cc4(nc(cc1(nc(=c(c=1cc(=o)[o-])c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12762 ==
+
== Metabolite UROPORPHYRINOGEN-III ==
 
* common-name:
 
* common-name:
** (2e,4e,6e)-2,6-dimethylocta-2,4,6-trienedial
+
** uroporphyrinogen-iii
 
* smiles:
 
* smiles:
** cc(=cc=o)c=cc=c(c=o)c
+
** c(=o)([o-])ccc3(c(=c2(cc5(nc(cc4(nc(cc1(nc(=c(c=1cc(=o)[o-])ccc(=o)[o-])cc(n2)=3))=c(cc(=o)[o-])c=4ccc(=o)[o-]))=c(cc([o-])=o)c(ccc(=o)[o-])=5)))cc(=o)[o-])
 
* inchi-key:
 
* inchi-key:
** ppjgvkzrxchmcc-lnfqzqfxsa-n
+
** huhwzxwwofsfkf-uhfffaoysa-f
 
* molecular-weight:
 
* molecular-weight:
** 164.204
+
** 828.742
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13403]]
 +
* [[UROGENDECARBOX-RXN]]
 +
* [[UROPORIIIMETHYLTRANSA-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11783]]
+
* [[UROGENIIISYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,4e,6e)-2,6-dimethylocta-2,4,6-trienedial}}
+
{{#set: common-name=uroporphyrinogen-iii}}
{{#set: inchi-key=inchikey=ppjgvkzrxchmcc-lnfqzqfxsa-n}}
+
{{#set: inchi-key=inchikey=huhwzxwwofsfkf-uhfffaoysa-f}}
{{#set: molecular-weight=164.204}}
+
{{#set: molecular-weight=828.742}}

Revision as of 08:29, 15 March 2021

Metabolite UROPORPHYRINOGEN-III

  • common-name:
    • uroporphyrinogen-iii
  • smiles:
    • c(=o)([o-])ccc3(c(=c2(cc5(nc(cc4(nc(cc1(nc(=c(c=1cc(=o)[o-])ccc(=o)[o-])cc(n2)=3))=c(cc(=o)[o-])c=4ccc(=o)[o-]))=c(cc([o-])=o)c(ccc(=o)[o-])=5)))cc(=o)[o-])
  • inchi-key:
    • huhwzxwwofsfkf-uhfffaoysa-f
  • molecular-weight:
    • 828.742

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality