Difference between revisions of "OHyW-58-tRNAPhe"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12762 == * common-name: ** (2e,4e,6e)-2,6-dimethylocta-2,4,6-trienedial * smiles: ** cc(=cc=o)c=cc=c(c=o)c * inchi-key: ** ppjgvkzrxc...") |
(Created page with "Category:metabolite == Metabolite UROPORPHYRINOGEN-III == * common-name: ** uroporphyrinogen-iii * smiles: ** c(=o)([o-])ccc3(c(=c2(cc5(nc(cc4(nc(cc1(nc(=c(c=1cc(=o)[o-])c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite UROPORPHYRINOGEN-III == |
* common-name: | * common-name: | ||
− | ** | + | ** uroporphyrinogen-iii |
* smiles: | * smiles: | ||
− | ** cc(=cc=o)c=cc=c( | + | ** c(=o)([o-])ccc3(c(=c2(cc5(nc(cc4(nc(cc1(nc(=c(c=1cc(=o)[o-])ccc(=o)[o-])cc(n2)=3))=c(cc(=o)[o-])c=4ccc(=o)[o-]))=c(cc([o-])=o)c(ccc(=o)[o-])=5)))cc(=o)[o-]) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** huhwzxwwofsfkf-uhfffaoysa-f |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 828.742 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-13403]] | ||
+ | * [[UROGENDECARBOX-RXN]] | ||
+ | * [[UROPORIIIMETHYLTRANSA-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[UROGENIIISYN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=uroporphyrinogen-iii}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=huhwzxwwofsfkf-uhfffaoysa-f}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=828.742}} |
Revision as of 08:29, 15 March 2021
Contents
Metabolite UROPORPHYRINOGEN-III
- common-name:
- uroporphyrinogen-iii
- smiles:
- c(=o)([o-])ccc3(c(=c2(cc5(nc(cc4(nc(cc1(nc(=c(c=1cc(=o)[o-])ccc(=o)[o-])cc(n2)=3))=c(cc(=o)[o-])c=4ccc(=o)[o-]))=c(cc([o-])=o)c(ccc(=o)[o-])=5)))cc(=o)[o-])
- inchi-key:
- huhwzxwwofsfkf-uhfffaoysa-f
- molecular-weight:
- 828.742