Difference between revisions of "OHyW-58-tRNAPhe"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P == * common-name: ** 3-deoxy-d-arabino-heptulosonate 7-phosphate * smiles: ** c(=o)([o-])c(=o)cc(o)c(...")
(Created page with "Category:metabolite == Metabolite OHyW-58-tRNAPhe == * common-name: ** 7-[4-methoxy-(2-hydroxy-3-amino-3-carboxypropyl)]-wyosine37 in trnaphe == Reaction(s) known to consu...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P ==
+
== Metabolite OHyW-58-tRNAPhe ==
 
* common-name:
 
* common-name:
** 3-deoxy-d-arabino-heptulosonate 7-phosphate
+
** 7-[4-methoxy-(2-hydroxy-3-amino-3-carboxypropyl)]-wyosine37 in trnaphe
* smiles:
 
** c(=o)([o-])c(=o)cc(o)c(o)c(o)cop([o-])(=o)[o-]
 
* inchi-key:
 
** pjwipexiffqaqz-pufimzngsa-k
 
* molecular-weight:
 
** 285.124
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3-DEHYDROQUINATE-SYNTHASE-RXN]]
+
* [[RXN-14540]]
* [[DAHPSYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DAHPSYN-RXN]]
+
* [[RXN-14539]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-deoxy-d-arabino-heptulosonate 7-phosphate}}
+
{{#set: common-name=7-[4-methoxy-(2-hydroxy-3-amino-3-carboxypropyl)]-wyosine37 in trnaphe}}
{{#set: inchi-key=inchikey=pjwipexiffqaqz-pufimzngsa-k}}
 
{{#set: molecular-weight=285.124}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite OHyW-58-tRNAPhe

  • common-name:
    • 7-[4-methoxy-(2-hydroxy-3-amino-3-carboxypropyl)]-wyosine37 in trnaphe

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "7-[4-methoxy-(2-hydroxy-3-amino-3-carboxypropyl)]-wyosine37 in trnaphe" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.