Difference between revisions of "OHyW-58-tRNAPhe"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-723 RXN0-723] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/1....")
(Created page with "Category:metabolite == Metabolite CPD-182 == * common-name: ** 4-methylumbelliferone * smiles: ** cc1(=cc(oc2(c=c(o)c=cc1=2))=o) * inchi-key: ** hshnitrmyyllcv-uhfffaoysa-...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-723 RXN0-723] ==
+
== Metabolite CPD-182 ==
* direction:
+
* common-name:
** left-to-right
+
** 4-methylumbelliferone
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.1.98.6 ec-1.1.98.6]
+
** cc1(=cc(oc2(c=c(o)c=cc1=2))=o)
== Reaction formula ==
+
* inchi-key:
* 1 [[CTP]][c] '''+''' 1 [[FORMATE]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[DCTP]][c] '''+''' 1 [[WATER]][c]
+
** hshnitrmyyllcv-uhfffaoysa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ17066]]
+
** 176.171
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
== Pathway(s) ==
+
* [[3.1.1.56-RXN]]
* [[PWY-7187]], pyrimidine deoxyribonucleotides de novo biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7187 PWY-7187]
+
* [[RXN-10769]]
** '''6''' reactions found over '''7''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
* [[PWY0-166]], superpathway of pyrimidine deoxyribonucleotides de novo biosynthesis (E. coli): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-166 PWY0-166]
+
{{#set: common-name=4-methylumbelliferone}}
** '''14''' reactions found over '''13''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=hshnitrmyyllcv-uhfffaoysa-n}}
== Reconstruction information  ==
+
{{#set: molecular-weight=176.171}}
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=51621 51621]
 
{{#set: direction=left-to-right}}
 
{{#set: ec-number=ec-1.1.98.6}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=2}}
 
{{#set: reconstruction category=orthology}}
 
{{#set: reconstruction tool=pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Revision as of 20:35, 18 December 2020

Metabolite CPD-182

  • common-name:
    • 4-methylumbelliferone
  • smiles:
    • cc1(=cc(oc2(c=c(o)c=cc1=2))=o)
  • inchi-key:
    • hshnitrmyyllcv-uhfffaoysa-n
  • molecular-weight:
    • 176.171

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality