Difference between revisions of "OHyW-tRNAPhe"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 4-HYDROXYBENZALDEHYDE == * common-name: ** 4-hydroxybenzaldehyde * smiles: ** [ch](c1(c=cc(o)=cc=1))=o * inchi-key: ** rghhsnmvtdwubi-uhf...")
(Created page with "Category:metabolite == Metabolite CPD-13004 == * common-name: ** angiotensin i * smiles: ** ccc(c)c(c(nc(cc1(=cn=cn1))c(n4(cccc(c(nc(c(nc(cc2(=cnc=n2))c(nc(cc(c)c)c([o-])=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 4-HYDROXYBENZALDEHYDE ==
+
== Metabolite CPD-13004 ==
 
* common-name:
 
* common-name:
** 4-hydroxybenzaldehyde
+
** angiotensin i
 
* smiles:
 
* smiles:
** [ch](c1(c=cc(o)=cc=1))=o
+
** ccc(c)c(c(nc(cc1(=cn=cn1))c(n4(cccc(c(nc(c(nc(cc2(=cnc=n2))c(nc(cc(c)c)c([o-])=o)=o)=o)cc3(c=cc=cc=3))=o)4))=o)=o)nc(c(cc5(c=cc(=cc=5)o))nc(c(c(c)c)nc(c(cccnc(=[n+])n)nc(c(cc(=o)[o-])[n+])=o)=o)=o)=o
 
* inchi-key:
 
* inchi-key:
** rghhsnmvtdwubi-uhfffaoysa-n
+
** orwyrwwvdcyomk-hbzpzaiksa-n
 
* molecular-weight:
 
* molecular-weight:
** 122.123
+
** 1296.491
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8872]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13600]]
+
* [[3.4.23.15-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-hydroxybenzaldehyde}}
+
{{#set: common-name=angiotensin i}}
{{#set: inchi-key=inchikey=rghhsnmvtdwubi-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=orwyrwwvdcyomk-hbzpzaiksa-n}}
{{#set: molecular-weight=122.123}}
+
{{#set: molecular-weight=1296.491}}

Revision as of 08:25, 15 March 2021

Metabolite CPD-13004

  • common-name:
    • angiotensin i
  • smiles:
    • ccc(c)c(c(nc(cc1(=cn=cn1))c(n4(cccc(c(nc(c(nc(cc2(=cnc=n2))c(nc(cc(c)c)c([o-])=o)=o)=o)cc3(c=cc=cc=3))=o)4))=o)=o)nc(c(cc5(c=cc(=cc=5)o))nc(c(c(c)c)nc(c(cccnc(=[n+])n)nc(c(cc(=o)[o-])[n+])=o)=o)=o)=o
  • inchi-key:
    • orwyrwwvdcyomk-hbzpzaiksa-n
  • molecular-weight:
    • 1296.491

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality