Difference between revisions of "OHyW-tRNAPhe"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ08350 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RR-BUTANEDIOL-DEHYDROGEN...") |
(Created page with "Category:metabolite == Metabolite CPD-490 == * common-name: ** α-d-xylose 1-phosphate * smiles: ** c1(c(c(c(co1)o)o)o)op([o-])([o-])=o * inchi-key: ** ilxhfxfppzgenn...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-490 == |
| − | + | * common-name: | |
| − | + | ** α-d-xylose 1-phosphate | |
| − | + | * smiles: | |
| − | * | + | ** c1(c(c(c(co1)o)o)o)op([o-])([o-])=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** ilxhfxfppzgenn-kkqcnmdgsa-l |
| − | == | + | * molecular-weight: |
| − | * [[ | + | ** 228.095 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | * [[ | + | * [[2.7.7.11-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | {{#set: | + | * [[2.7.7.11-RXN]] |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| − | {{#set: | + | {{#set: common-name=α-d-xylose 1-phosphate}} |
| + | {{#set: inchi-key=inchikey=ilxhfxfppzgenn-kkqcnmdgsa-l}} | ||
| + | {{#set: molecular-weight=228.095}} | ||
Revision as of 20:31, 18 December 2020
Contents
Metabolite CPD-490
- common-name:
- α-d-xylose 1-phosphate
- smiles:
- c1(c(c(c(co1)o)o)o)op([o-])([o-])=o
- inchi-key:
- ilxhfxfppzgenn-kkqcnmdgsa-l
- molecular-weight:
- 228.095
