Difference between revisions of "OLEATE-CPD"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4441 == * common-name: ** cis-zeatin * smiles: ** cc(co)=ccnc2(c1(=c(nc=n1)n=cn=2)) * inchi-key: ** uzkqtcbamswpjd-uqcoibpssa-n * mol...")
(Created page with "Category:metabolite == Metabolite OLEATE-CPD == * common-name: ** oleate * smiles: ** ccccccccc=ccccccccc([o-])=o * inchi-key: ** zqppmhvwecsirj-ktkrtigzsa-m * molecular-w...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-4441 ==
+
== Metabolite OLEATE-CPD ==
 
* common-name:
 
* common-name:
** cis-zeatin
+
** oleate
 
* smiles:
 
* smiles:
** cc(co)=ccnc2(c1(=c(nc=n1)n=cn=2))
+
** ccccccccc=ccccccccc([o-])=o
 
* inchi-key:
 
* inchi-key:
** uzkqtcbamswpjd-uqcoibpssa-n
+
** zqppmhvwecsirj-ktkrtigzsa-m
 
* molecular-weight:
 
* molecular-weight:
** 219.246
+
** 281.457
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-4733]]
+
* [[FACOAL18111Z]]
 +
* [[RXN-10756]]
 +
* [[RXN-9644]]
 +
* [[RXN0-7239]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[FACOAE18111Z]]
 +
* [[RXN-10756]]
 +
* [[RXN-15035]]
 +
* [[RXN-15067]]
 +
* [[RXN-15068]]
 +
* [[RXN-15088]]
 +
* [[RXN-15089]]
 +
* [[RXN-15133]]
 +
* [[RXN-15135]]
 +
* [[RXN-9666]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cis-zeatin}}
+
{{#set: common-name=oleate}}
{{#set: inchi-key=inchikey=uzkqtcbamswpjd-uqcoibpssa-n}}
+
{{#set: inchi-key=inchikey=zqppmhvwecsirj-ktkrtigzsa-m}}
{{#set: molecular-weight=219.246}}
+
{{#set: molecular-weight=281.457}}

Latest revision as of 11:16, 18 March 2021

Metabolite OLEATE-CPD

  • common-name:
    • oleate
  • smiles:
    • ccccccccc=ccccccccc([o-])=o
  • inchi-key:
    • zqppmhvwecsirj-ktkrtigzsa-m
  • molecular-weight:
    • 281.457

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality