Difference between revisions of "OLEATE-CPD"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4441 == * common-name: ** cis-zeatin * smiles: ** cc(co)=ccnc2(c1(=c(nc=n1)n=cn=2)) * inchi-key: ** uzkqtcbamswpjd-uqcoibpssa-n * mol...") |
(Created page with "Category:metabolite == Metabolite OLEATE-CPD == * common-name: ** oleate * smiles: ** ccccccccc=ccccccccc([o-])=o * inchi-key: ** zqppmhvwecsirj-ktkrtigzsa-m * molecular-w...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD | + | == Metabolite OLEATE-CPD == |
* common-name: | * common-name: | ||
− | ** | + | ** oleate |
* smiles: | * smiles: | ||
− | ** | + | ** ccccccccc=ccccccccc([o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** zqppmhvwecsirj-ktkrtigzsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 281.457 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[FACOAL18111Z]] |
+ | * [[RXN-10756]] | ||
+ | * [[RXN-9644]] | ||
+ | * [[RXN0-7239]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[FACOAE18111Z]] | ||
+ | * [[RXN-10756]] | ||
+ | * [[RXN-15035]] | ||
+ | * [[RXN-15067]] | ||
+ | * [[RXN-15068]] | ||
+ | * [[RXN-15088]] | ||
+ | * [[RXN-15089]] | ||
+ | * [[RXN-15133]] | ||
+ | * [[RXN-15135]] | ||
+ | * [[RXN-9666]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=oleate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zqppmhvwecsirj-ktkrtigzsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=281.457}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite OLEATE-CPD
- common-name:
- oleate
- smiles:
- ccccccccc=ccccccccc([o-])=o
- inchi-key:
- zqppmhvwecsirj-ktkrtigzsa-m
- molecular-weight:
- 281.457
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- FACOAE18111Z
- RXN-10756
- RXN-15035
- RXN-15067
- RXN-15068
- RXN-15088
- RXN-15089
- RXN-15133
- RXN-15135
- RXN-9666