Difference between revisions of "OLEATE-CPD"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ARG == * common-name: ** l-arginine * smiles: ** c(nc(n)=[n+])ccc([n+])c(=o)[o-] * inchi-key: ** odksfydxxfifqn-bypyzucnsa-o * molecular-...")
(Created page with "Category:metabolite == Metabolite OLEATE-CPD == * common-name: ** oleate * smiles: ** ccccccccc=ccccccccc([o-])=o * inchi-key: ** zqppmhvwecsirj-ktkrtigzsa-m * molecular-w...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ARG ==
+
== Metabolite OLEATE-CPD ==
 
* common-name:
 
* common-name:
** l-arginine
+
** oleate
 
* smiles:
 
* smiles:
** c(nc(n)=[n+])ccc([n+])c(=o)[o-]
+
** ccccccccc=ccccccccc([o-])=o
 
* inchi-key:
 
* inchi-key:
** odksfydxxfifqn-bypyzucnsa-o
+
** zqppmhvwecsirj-ktkrtigzsa-m
 
* molecular-weight:
 
* molecular-weight:
** 175.21
+
** 281.457
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.5.1.11-RXN]]
+
* [[FACOAL18111Z]]
* [[1.5.1.19-RXN]]
+
* [[RXN-10756]]
* [[ARG-OXIDATION-RXN]]
+
* [[RXN-9644]]
* [[ARGDECARBOX-RXN]]
+
* [[RXN0-7239]]
* [[ARGINASE-RXN]]
 
* [[ARGININE--TRNA-LIGASE-RXN]]
 
* [[ARGSUCCINLYA-RXN]]
 
* [[NITRIC-OXIDE-SYNTHASE-RXN]]
 
* [[RXN-13564]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ARGDECARBOX-RXN]]
+
* [[FACOAE18111Z]]
* [[ARGINASE-RXN]]
+
* [[RXN-10756]]
* [[ARGSUCCINLYA-RXN]]
+
* [[RXN-15035]]
* [[D-OCTOPINE-DEHYDROGENASE-RXN]]
+
* [[RXN-15067]]
 +
* [[RXN-15068]]
 +
* [[RXN-15088]]
 +
* [[RXN-15089]]
 +
* [[RXN-15133]]
 +
* [[RXN-15135]]
 +
* [[RXN-9666]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-arginine}}
+
{{#set: common-name=oleate}}
{{#set: inchi-key=inchikey=odksfydxxfifqn-bypyzucnsa-o}}
+
{{#set: inchi-key=inchikey=zqppmhvwecsirj-ktkrtigzsa-m}}
{{#set: molecular-weight=175.21}}
+
{{#set: molecular-weight=281.457}}

Latest revision as of 11:16, 18 March 2021

Metabolite OLEATE-CPD

  • common-name:
    • oleate
  • smiles:
    • ccccccccc=ccccccccc([o-])=o
  • inchi-key:
    • zqppmhvwecsirj-ktkrtigzsa-m
  • molecular-weight:
    • 281.457

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality