Difference between revisions of "OLEOYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DNA-Ligase-L-lysine == * common-name: ** a [dna ligase]-l-lysine == Reaction(s) known to consume the compound == * RXN-17917 * RXN-...")
(Created page with "Category:metabolite == Metabolite OLEOYL-COA == * common-name: ** oleoyl-coa * smiles: ** ccccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DNA-Ligase-L-lysine ==
+
== Metabolite OLEOYL-COA ==
 
* common-name:
 
* common-name:
** a [dna ligase]-l-lysine
+
** oleoyl-coa
 +
* smiles:
 +
** ccccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** xduhqpoxluavee-bpmmelmssa-j
 +
* molecular-weight:
 +
** 1027.953
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17917]]
+
* [[RXN-13322]]
* [[RXN-17920]]
+
* [[RXN-15036]]
* [[RXN-17921]]
+
* [[RXN-15043]]
* [[RXN-17924]]
+
* [[RXN-15044]]
 +
* [[RXN-15045]]
 +
* [[RXN-15090]]
 +
* [[RXN-17775]]
 +
* [[RXN-9601]]
 +
* [[RXN-9666]]
 +
* [[RXN-9670]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17918]]
+
* [[1.14.19.1-RXN]]
* [[RXN-17922]]
+
* [[RXN-15036]]
 +
* [[RXN-9644]]
 +
* [[RXN-9670]]
 +
* [[RXN0-7239]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [dna ligase]-l-lysine}}
+
{{#set: common-name=oleoyl-coa}}
 +
{{#set: inchi-key=inchikey=xduhqpoxluavee-bpmmelmssa-j}}
 +
{{#set: molecular-weight=1027.953}}

Latest revision as of 11:11, 18 March 2021

Metabolite OLEOYL-COA

  • common-name:
    • oleoyl-coa
  • smiles:
    • ccccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • xduhqpoxluavee-bpmmelmssa-j
  • molecular-weight:
    • 1027.953

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality