Difference between revisions of "OLEOYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Cyclic-Phosphate-Terminated-RNAs == * common-name: ** an [rna]-3'-ribunucleoside-2',3'-cyclophosphate == Reaction(s) known to consume the...") |
(Created page with "Category:metabolite == Metabolite OLEOYL-COA == * common-name: ** oleoyl-coa * smiles: ** ccccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])...") |
||
(2 intermediate revisions by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite OLEOYL-COA == |
* common-name: | * common-name: | ||
− | ** | + | ** oleoyl-coa |
+ | * smiles: | ||
+ | ** ccccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
+ | * inchi-key: | ||
+ | ** xduhqpoxluavee-bpmmelmssa-j | ||
+ | * molecular-weight: | ||
+ | ** 1027.953 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-13322]] | ||
+ | * [[RXN-15036]] | ||
+ | * [[RXN-15043]] | ||
+ | * [[RXN-15044]] | ||
+ | * [[RXN-15045]] | ||
+ | * [[RXN-15090]] | ||
+ | * [[RXN-17775]] | ||
+ | * [[RXN-9601]] | ||
+ | * [[RXN-9666]] | ||
+ | * [[RXN-9670]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[1.14.19.1-RXN]] |
+ | * [[RXN-15036]] | ||
+ | * [[RXN-9644]] | ||
+ | * [[RXN-9670]] | ||
+ | * [[RXN0-7239]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=oleoyl-coa}} |
+ | {{#set: inchi-key=inchikey=xduhqpoxluavee-bpmmelmssa-j}} | ||
+ | {{#set: molecular-weight=1027.953}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite OLEOYL-COA
- common-name:
- oleoyl-coa
- smiles:
- ccccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- xduhqpoxluavee-bpmmelmssa-j
- molecular-weight:
- 1027.953