Difference between revisions of "OLIGOPEPTIDES"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite D-RIBULOSE-15-P2 == * common-name: ** d-ribulose-1,5-bisphosphate * smiles: ** c(op([o-])([o-])=o)c(o)c(o)c(=o)cop(=o)([o-])[o-] * inchi-...")
(Created page with "Category:metabolite == Metabolite OLIGOPEPTIDES == * common-name: ** an oligopeptide == Reaction(s) known to consume the compound == * 3.4.16.2-RXN * 3.4.21.83-RXN...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite D-RIBULOSE-15-P2 ==
+
== Metabolite OLIGOPEPTIDES ==
 
* common-name:
 
* common-name:
** d-ribulose-1,5-bisphosphate
+
** an oligopeptide
* smiles:
 
** c(op([o-])([o-])=o)c(o)c(o)c(=o)cop(=o)([o-])[o-]
 
* inchi-key:
 
** yahzabjorduqgo-nqxxgfsbsa-j
 
* molecular-weight:
 
** 306.059
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PHOSPHORIBULOKINASE-RXN]]
+
* [[3.4.16.2-RXN]]
* [[RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN]]
+
* [[3.4.21.83-RXN]]
 +
* [[3.4.24.70-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PHOSPHORIBULOKINASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-ribulose-1,5-bisphosphate}}
+
{{#set: common-name=an oligopeptide}}
{{#set: inchi-key=inchikey=yahzabjorduqgo-nqxxgfsbsa-j}}
 
{{#set: molecular-weight=306.059}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite OLIGOPEPTIDES

  • common-name:
    • an oligopeptide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality