Difference between revisions of "OLIGOPEPTIDES"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8607 == * common-name: ** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol * smiles: ** cc(c)cccc([ch]4(c1(c)(c...")
(Created page with "Category:metabolite == Metabolite TMP == * common-name: ** dtmp * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])[o-])o2)) * inchi-key: ** gyozywvxfndglu-xlpzgreqs...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8607 ==
+
== Metabolite TMP ==
 
* common-name:
 
* common-name:
** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol
+
** dtmp
 
* smiles:
 
* smiles:
** cc(c)cccc([ch]4(c1(c)(c(co)(c2(=c(cc1)c3(c)([ch](cc2)c(c)(c)c(o)cc3)))cc4)))c
+
** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])[o-])o2))
 
* inchi-key:
 
* inchi-key:
** sjpdnxkpbqhpmz-puxrvuthsa-n
+
** gyozywvxfndglu-xlpzgreqsa-l
 
* molecular-weight:
 
* molecular-weight:
** 444.74
+
** 320.195
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-12]]
+
* [[ATDTM]]
 +
* [[DTMPKI-RXN]]
 +
* [[MDUMT]]
 +
* [[TPH]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-11]]
+
* [[MDUMT]]
 +
* [[RXN-14200]]
 +
* [[RXN-14213]]
 +
* [[RXN0-5107]]
 +
* [[THYMIDYLATESYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol}}
+
{{#set: common-name=dtmp}}
{{#set: inchi-key=inchikey=sjpdnxkpbqhpmz-puxrvuthsa-n}}
+
{{#set: inchi-key=inchikey=gyozywvxfndglu-xlpzgreqsa-l}}
{{#set: molecular-weight=444.74}}
+
{{#set: molecular-weight=320.195}}

Revision as of 18:53, 14 January 2021

Metabolite TMP

  • common-name:
    • dtmp
  • smiles:
    • cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])[o-])o2))
  • inchi-key:
    • gyozywvxfndglu-xlpzgreqsa-l
  • molecular-weight:
    • 320.195

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality