Difference between revisions of "ORN-AMINOPENTANOATE-CAT-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1308 CPD0-1308] == * common-name: ** glyphosate * smiles: ** c(ncc(=o)[o-])p(o)([o-])=o *...") |
(Created page with "Category:pathway == Pathway ORN-AMINOPENTANOATE-CAT-PWY == * taxonomic-range: ** tax-1224 ** tax-1239 * common-name: ** l-ornithine degradation i (l-proline biosynthesis)...") |
||
(7 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:pathway]] |
− | == | + | == Pathway ORN-AMINOPENTANOATE-CAT-PWY == |
+ | * taxonomic-range: | ||
+ | ** tax-1224 | ||
+ | ** tax-1239 | ||
* common-name: | * common-name: | ||
− | ** | + | ** l-ornithine degradation i (l-proline biosynthesis) |
− | + | == Reaction(s) found == | |
− | + | * [[ORNITHINE-CYCLODEAMINASE-RXN]] | |
− | + | == Reaction(s) not found == | |
− | + | All reactions of this pathways are in present | |
− | + | {{#set: taxonomic-range=tax-1239|tax-1224}} | |
− | + | {{#set: common-name=l-ornithine degradation i (l-proline biosynthesis)}} | |
− | == Reaction(s) | + | {{#set: nb reaction found=1}} |
− | * [[RXN | + | {{#set: completion rate=1.0}} |
− | == Reaction(s) | + | {{#set: nb total reaction=1}} |
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: |
Latest revision as of 10:57, 18 March 2021
Pathway ORN-AMINOPENTANOATE-CAT-PWY
- taxonomic-range:
- tax-1224
- tax-1239
- common-name:
- l-ornithine degradation i (l-proline biosynthesis)
Reaction(s) found
Reaction(s) not found
All reactions of this pathways are in present