Difference between revisions of "ORN-AMINOPENTANOATE-CAT-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Enones Enones] == * common-name: ** an enone == Reaction(s) known to consume the compound == *...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] == * common-name: ** l-canavanine * smiles: ** c(cc([n+])c(=o)[o-])onc(=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-canavanine |
| + | * smiles: | ||
| + | ** c(cc([n+])c(=o)[o-])onc(=[n+])n | ||
| + | * inchi-key: | ||
| + | ** fsbigdsbmbyopn-vkhmyheasa-o | ||
| + | * molecular-weight: | ||
| + | ** 177.183 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-34]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-22]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-canavanine}} |
| + | {{#set: inchi-key=inchikey=fsbigdsbmbyopn-vkhmyheasa-o}} | ||
| + | {{#set: molecular-weight=177.183}} | ||
Revision as of 14:18, 26 August 2019
Contents
Metabolite CANAVANINE
- common-name:
- l-canavanine
- smiles:
- c(cc([n+])c(=o)[o-])onc(=[n+])n
- inchi-key:
- fsbigdsbmbyopn-vkhmyheasa-o
- molecular-weight:
- 177.183
