Difference between revisions of "ORN-AMINOPENTANOATE-CAT-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] == * common-name: ** l-canavanine * smiles: ** c(cc([n+])c(=o)[o-])onc(=...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1308 CPD0-1308] == * common-name: ** glyphosate * smiles: ** c(ncc(=o)[o-])p(o)([o-])=o *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1308 CPD0-1308] == |
* common-name: | * common-name: | ||
| − | ** | + | ** glyphosate |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(ncc(=o)[o-])p(o)([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xddaorkbjwwyjs-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 167.058 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-17951]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=glyphosate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xddaorkbjwwyjs-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=167.058}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD0-1308
- common-name:
- glyphosate
- smiles:
- c(ncc(=o)[o-])p(o)([o-])=o
- inchi-key:
- xddaorkbjwwyjs-uhfffaoysa-l
- molecular-weight:
- 167.058
