Difference between revisions of "ORN-AMINOPENTANOATE-CAT-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1308 CPD0-1308] == * common-name: ** glyphosate * smiles: ** c(ncc(=o)[o-])p(o)([o-])=o *...") |
(Created page with "Category:pathway == Pathway PWY-6415 == * taxonomic-range: ** tax-3038 * common-name: ** l-ascorbate biosynthesis v == Reaction(s) found == * RXN-11153 * UDP-GLUCURO...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:pathway]] |
− | == | + | == Pathway PWY-6415 == |
+ | * taxonomic-range: | ||
+ | ** tax-3038 | ||
* common-name: | * common-name: | ||
− | ** | + | ** l-ascorbate biosynthesis v |
− | + | == Reaction(s) found == | |
− | * | + | * [[RXN-11153]] |
− | * | + | * [[UDP-GLUCURONATE-4-EPIMERASE-RXN]] |
− | + | == Reaction(s) not found == | |
− | + | * [NoneRXN-11147 RXN-11147] | |
− | + | * [NoneRXN-11151 RXN-11151] | |
− | == Reaction(s) | + | * [NoneRXN-11150 RXN-11150] |
− | * [[RXN- | + | * [NoneRXN-11152 RXN-11152] |
− | + | * [NoneRXN-14753 RXN-14753] | |
− | = | + | {{#set: taxonomic-range=tax-3038}} |
− | {{#set: common-name= | + | {{#set: common-name=l-ascorbate biosynthesis v}} |
− | {{#set: | + | {{#set: nb reaction found=2}} |
− | {{#set: | + | {{#set: completion rate=0.29}} |
+ | {{#set: nb total reaction=7}} |
Revision as of 20:16, 18 December 2020
Pathway PWY-6415
- taxonomic-range:
- tax-3038
- common-name:
- l-ascorbate biosynthesis v
Reaction(s) found
Reaction(s) not found
- [NoneRXN-11147 RXN-11147]
- [NoneRXN-11151 RXN-11151]
- [NoneRXN-11150 RXN-11150]
- [NoneRXN-11152 RXN-11152]
- [NoneRXN-14753 RXN-14753]