Difference between revisions of "ORNDEG-PWY"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOPORPHYRIN_IX PROTOPORPHYRIN_IX] ==
+== Pathway ORNDEG-PWY ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** protoporphyrin ix
+** superpathway of ornithine degradation
-* smiles:
+== Reaction(s) found ==
-** c=cc1(c(c)=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(c(c=c)=c(c)c(=cc=1n2)n=3))n4))=n5)))
+* [[ORNDECARBOX-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** ksfovussgskxfi-ujjxfscmsa-l
+* [NoneRXN-6423 RXN-6423]
-* molecular-weight:
+{{#set: taxonomic-range=tax-2}}
-** 560.651
+{{#set: common-name=superpathway of ornithine degradation}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[PROTOHEMEFERROCHELAT-RXN]]
+{{#set: completion rate=0.5}}
-* [[RXN1F-20]]
+{{#set: nb total reaction=2}}
-== Reaction(s) known to produce the compound ==
-* [[PPPGO]]
-* [[PROTOHEMEFERROCHELAT-RXN]]
-* [[PROTOPORGENOXI-RXN]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=protoporphyrin ix}}
-{{#set: inchi-key=inchikey=ksfovussgskxfi-ujjxfscmsa-l}}
-{{#set: molecular-weight=560.651}}