Difference between revisions of "OROTATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TYRAMINE == * common-name: ** tyramine * smiles: ** c1(c=c(o)c=cc(cc[n+])=1) * inchi-key: ** dzgwfcgjzkjufp-uhfffaoysa-o * molecular-weig...") |
(Created page with "Category:metabolite == Metabolite OROTATE == * common-name: ** orotate * smiles: ** c1(=c(c([o-])=o)nc(nc(=o)1)=o) * inchi-key: ** pxqpewdeaktcgb-uhfffaoysa-m * molecular-...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite OROTATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** orotate |
* smiles: | * smiles: | ||
| − | ** c1( | + | ** c1(=c(c([o-])=o)nc(nc(=o)1)=o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pxqpewdeaktcgb-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 155.09 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[OROPRIBTRANS-RXN]] |
| + | * [[ORPRT]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DIHYDROOROTATE-DEHYDROGENASE-RXN]] |
| + | * [[OROPRIBTRANS-RXN]] | ||
| + | * [[ORPRT]] | ||
| + | * [[RXN0-6491]] | ||
| + | * [[RXN0-6554]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=orotate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pxqpewdeaktcgb-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=155.09}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite OROTATE
- common-name:
- orotate
- smiles:
- c1(=c(c([o-])=o)nc(nc(=o)1)=o)
- inchi-key:
- pxqpewdeaktcgb-uhfffaoysa-m
- molecular-weight:
- 155.09
